CAS 152434-79-2 appears in our catalog under these names: 2-(Benzyloxy)-1,4-difluorobenzene, 95%, 2-(Benzyloxy)-1,4-difluorobenzene, 98%, 2-(Benzyloxy)-1,4-difluorobenzene, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 10g, 100g, 5g, 1g.
1,4-difluoro-2-phenylmethoxybenzene (CAS 152434-79-2) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 1,4-difluoro-2-phenylmethoxybenzene. InChIKey: RJMFCDBACQVFJY-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 1,4-difluoro-2-phenylmethoxybenzene |
| InChIKey | RJMFCDBACQVFJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)