Products 947279-21-2

CAS 947279-21-2 is the registry number for 2-Benzyloxy-1,3-difluorobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1,3-difluoro-2-phenylmethoxybenzene (CAS 947279-21-2) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 1,3-difluoro-2-phenylmethoxybenzene. InChIKey: ALXMAFHTTMQWSW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10F2O
Molecular weight220.21 g/mol
IUPAC name1,3-difluoro-2-phenylmethoxybenzene
InChIKeyALXMAFHTTMQWSW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=CC=C2F)F

Computed by PubChem (NCBI)