CAS 153877-56-6 is the registry number for 3,5-Difluorobenzhydrol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3,5-difluorophenyl)-phenylmethanol (CAS 153877-56-6) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: (3,5-difluorophenyl)-phenylmethanol. InChIKey: MZBBRGLZQRMJPL-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | (3,5-difluorophenyl)-phenylmethanol |
| InChIKey | MZBBRGLZQRMJPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=CC(=C2)F)F)O |
Computed by PubChem (NCBI)