cas: 198649-68-2 — see every product listed under this CAS number, including other names
1-(Bromomethyl)-2-(trifluoromethoxy)benzene 96% (stabilized withHQ+CaCO3) (CAS 198649-68-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A639294-5g |
| cas | 198649-68-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 381.50 Pln |
| purity | 96% (stabilized withHQ+CaCO3) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A639294 |
1-(bromomethyl)-2-(trifluoromethoxy)benzene (CAS 198649-68-2) is a chemical compound with the molecular formula C8H6BrF3O and a molecular weight of 255.03 g/mol. IUPAC name: 1-(bromomethyl)-2-(trifluoromethoxy)benzene. InChIKey: TUNSVUOTVLWNQT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | 1-(bromomethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | TUNSVUOTVLWNQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)