cas: 116827-40-8 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-2-(trifluoromethoxy)benzene, 98% (CAS 116827-40-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F319446-1G |
| cas | 116827-40-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 513.38 Pln | |
| Fluorochem | 10g | 732.05 Pln | |
| Fluorochem | 25g | 1377.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(chloromethyl)-2-(trifluoromethoxy)benzene (CAS 116827-40-8) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(chloromethyl)-2-(trifluoromethoxy)benzene. InChIKey: ZGXDTWNEZOBSBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | ZGXDTWNEZOBSBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)OC(F)(F)F |
Computed by PubChem (NCBI)