cas: 116827-40-8 — see every product listed under this CAS number, including other names
2–(Trifluoromethoxy)benzyl chloride (CAS 116827-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD21914-100g |
| cas | 116827-40-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 2469.24 Pln | |
| GLPBio | 10g | 770.22 Pln | |
| GLPBio | 1g | 611.08 Pln | |
| GLPBio | 25g | 1121.26 Pln | |
| GLPBio | 5g | 653.21 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(chloromethyl)-2-(trifluoromethoxy)benzene (CAS 116827-40-8) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(chloromethyl)-2-(trifluoromethoxy)benzene. InChIKey: ZGXDTWNEZOBSBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2-(trifluoromethoxy)benzene |
| InChIKey | ZGXDTWNEZOBSBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)OC(F)(F)F |
Computed by PubChem (NCBI)