cas: 65796-00-1 — see every product listed under this CAS number, including other names
1-(Chloromethyl)-4-(trifluoromethoxy)benzene 98% (stabilized with HQ+CaCO3) (CAS 65796-00-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A315113-5g |
| cas | 65796-00-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 209.06 Pln |
| purity | 98% (stabilized with HQ+CaCO3) |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A315113 |
1-(chloromethyl)-4-(trifluoromethoxy)benzene (CAS 65796-00-1) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(chloromethyl)-4-(trifluoromethoxy)benzene. InChIKey: LBMKFQMJURUPKC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(trifluoromethoxy)benzene |
| InChIKey | LBMKFQMJURUPKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)OC(F)(F)F |
Computed by PubChem (NCBI)