cas: 65796-00-1 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)benzyl chloride (CAS 65796-00-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007553-1G |
| cas | 65796-00-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 227.02 Pln | |
| Fluorochem | 100g | 685.19 Pln |
| delivery time | 3-4 weeks |
|---|
1-(chloromethyl)-4-(trifluoromethoxy)benzene (CAS 65796-00-1) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: 1-(chloromethyl)-4-(trifluoromethoxy)benzene. InChIKey: LBMKFQMJURUPKC-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(chloromethyl)-4-(trifluoromethoxy)benzene |
| InChIKey | LBMKFQMJURUPKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)OC(F)(F)F |
Computed by PubChem (NCBI)