cas: 91544-03-5 — see every product listed under this CAS number, including other names
1-(Isoquinolin-3-yl)ethanone, 97%, 97% (CAS 91544-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTUI-100mg |
| cas | 91544-03-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 2483.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-isoquinolin-3-ylethanone (CAS 91544-03-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-isoquinolin-3-ylethanone. InChIKey: NLMXNLJJYMMQIF-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-isoquinolin-3-ylethanone |
| InChIKey | NLMXNLJJYMMQIF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=CC=CC=C2C=N1 |
Computed by PubChem (NCBI)