Products 24091-02-9

CAS 24091-02-9 is the registry number for 2-Naphthaldehyde oxime, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 10g, 5g.

Structural formula: {0} (CAS {1})

N-(naphthalen-2-ylmethylidene)hydroxylamine (CAS 24091-02-9) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: N-(naphthalen-2-ylmethylidene)hydroxylamine. InChIKey: VJSUSMMBIMGSHW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO
Molecular weight171.19 g/mol
IUPAC nameN-(naphthalen-2-ylmethylidene)hydroxylamine
InChIKeyVJSUSMMBIMGSHW-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)C=NO

Computed by PubChem (NCBI)