CAS 68223-13-2 appears in our catalog under these names: 4-(Pyridin-3-yl)phenol, 95%, 4-(Pyridin-3-yl)phenol, 95+%, 4-(pyridin-3-yl)phenol, 4-Pyridin-3-ylphenol, ≥95%. Offered by: Combi-blocks, AmBeed, TRC, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4-pyridin-3-ylphenol (CAS 68223-13-2) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyridin-3-ylphenol. InChIKey: WQTVIWDQIXIEOD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyridin-3-ylphenol |
| InChIKey | WQTVIWDQIXIEOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)