CAS 2243-81-4 appears in our catalog under these names: 1-Naphthalenecarboxamide, 98%, 1-Naphthamide, >95% (HPLC), alpha-Naphthamide, 1-Naphthamide, 97%, 97%, 1-Naphthalimide, 97%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 100mg, 10mg, 50mg.
Naphthalene-1-carboxamide (CAS 2243-81-4) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: naphthalene-1-carboxamide. InChIKey: RMHJJUOPOWPRBP-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | naphthalene-1-carboxamide |
| InChIKey | RMHJJUOPOWPRBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)N |
Computed by PubChem (NCBI)