CAS 77409-99-5 appears in our catalog under these names: 4-(Pyridin-4-yl)phenol, 95%, 4–(Pyridin–4–yl)phenol, 4-(Pyridin-4-yl)phenol, 4-(Pyridin-4-yl)phenol 95%, 4-(Pyridin-4-yl)phenol, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg.
4-pyridin-4-ylphenol (CAS 77409-99-5) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 4-pyridin-4-ylphenol. InChIKey: DANMQSWQAGVFKV-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 4-pyridin-4-ylphenol |
| InChIKey | DANMQSWQAGVFKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=NC=C2)O |
Computed by PubChem (NCBI)