CAS 2176-45-6 appears in our catalog under these names: 3-Phenoxypyridine, 97%, 3–phenoxypyridine, 3-Phenoxypyridine, 98%, 98%, 3-Phenoxypyridine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 100mg, 250mg.
3-phenoxypyridine (CAS 2176-45-6) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 3-phenoxypyridine. InChIKey: KDGUIKPOZGYLQJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 3-phenoxypyridine |
| InChIKey | KDGUIKPOZGYLQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CN=CC=C2 |
Computed by PubChem (NCBI)