cas: 1821737-68-1 — see every product listed under this CAS number, including other names
1-(Phenylmethyl) (3S,5R)-5-methyl-1,3-piperidinedicarboxylate, 97%, 97% (CAS 1821737-68-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JW3Y-100mg |
| cas | 1821737-68-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1053.20 Pln | |
| Chemat | 250mg | 1653.20 Pln | |
| Chemat | 500mg | 2709.20 Pln | |
| Chemat | 1g | 4029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid (CAS 1821737-68-1) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: (3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid. InChIKey: SOYXQVSBDHHRLV-YPMHNXCESA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | (3S,5R)-5-methyl-1-phenylmethoxycarbonylpiperidine-3-carboxylic acid |
| InChIKey | SOYXQVSBDHHRLV-YPMHNXCESA-N |
| SMILES | C[C@@H]1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)