cas: 479552-82-4 — see every product listed under this CAS number, including other names
1-(TERT-BUTYL) 5-METHYL 3-BROMO-1H-INDOLE-1,5-DICARBOXYLATE, ≥95%, ≥95% (CAS 479552-82-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132RM1-100mg |
| cas | 479552-82-4 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 722.00 Pln | |
| Chemat | 250mg | 1053.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 5g | 5507.60 Pln | |
| Chemat | 10g | 8848.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate (CAS 479552-82-4) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate. InChIKey: KGLJNKRRIRJQBS-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate |
| InChIKey | KGLJNKRRIRJQBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)