cas: 479552-82-4 — see every product listed under this CAS number, including other names
1-(TERT-BUTYL) 5-METHYL 3-BROMO-1H-INDOLE-1,5-DICARBOXYLATE (CAS 479552-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F537956-250MG |
| cas | 479552-82-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1716.08 Pln | |
| Fluorochem | 1g | 4183.96 Pln |
| delivery time | 3-4 weeks |
|---|
1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate (CAS 479552-82-4) is a chemical compound with the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. IUPAC name: 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate. InChIKey: KGLJNKRRIRJQBS-UHFFFAOYSA-N.
| Molecular formula | C15H16BrNO4 |
|---|---|
| Molecular weight | 354.20 g/mol |
| IUPAC name | 1-O-tert-butyl 5-O-methyl 3-bromoindole-1,5-dicarboxylate |
| InChIKey | KGLJNKRRIRJQBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=CC(=C2)C(=O)OC)Br |
Computed by PubChem (NCBI)