cas: 175277-09-5 — see every product listed under this CAS number, including other names
1-(tert-Butyl)-3-methyl-1h-pyrazole-5-carboxylic acid, 98% (CAS 175277-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 50g, 100g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QI-8741-250mg |
| cas | 175277-09-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| AmBeed | 100mg | 109.06 Pln | |
| AmBeed | 250mg | 122.08 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 378.01 Pln | |
| Fluorochem | 50g | 3262.41 Pln | |
| Fluorochem | 100g | 5475.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-tert-butyl-5-methylpyrazole-3-carboxylic acid (CAS 175277-09-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 2-tert-butyl-5-methylpyrazole-3-carboxylic acid. InChIKey: JZPMLZWJUMATOQ-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2-tert-butyl-5-methylpyrazole-3-carboxylic acid |
| InChIKey | JZPMLZWJUMATOQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)