cas: 1248072-48-1 — see every product listed under this CAS number, including other names
1-[4-(Chloromethyl)phenyl]-3-methyl-1H-pyrazole 95% (CAS 1248072-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1029581-100mg |
| cas | 1248072-48-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 2033.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1029581 |
1-[4-(chloromethyl)phenyl]-3-methylpyrazole (CAS 1248072-48-1) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 1-[4-(chloromethyl)phenyl]-3-methylpyrazole. InChIKey: LOPFWVAUDUDBII-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 1-[4-(chloromethyl)phenyl]-3-methylpyrazole |
| InChIKey | LOPFWVAUDUDBII-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1)C2=CC=C(C=C2)CCl |
Computed by PubChem (NCBI)