cas: 2094-72-6 — see every product listed under this CAS number, including other names
1-Adamantanecarbonyl Chloride, >97.0%(GC)(T) (CAS 2094-72-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0717-5G |
| cas | 2094-72-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 355.86 Pln | |
| TCI | 25g | 872.17 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
Adamantane-1-carbonyl chloride (CAS 2094-72-6) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: adamantane-1-carbonyl chloride. InChIKey: MIBQYWIOHFTKHD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | adamantane-1-carbonyl chloride |
| InChIKey | MIBQYWIOHFTKHD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)Cl |
Computed by PubChem (NCBI)