cas: 2094-72-6 — see every product listed under this CAS number, including other names
Adamantane-1-carbonyl chloride, 98%, 98% (CAS 2094-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113K9E-1g |
| cas | 2094-72-6 |
| size | 1g |
| availability | 128g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 251.60 Pln | |
| Chemat | 100g | 837.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Adamantane-1-carbonyl chloride (CAS 2094-72-6) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: adamantane-1-carbonyl chloride. InChIKey: MIBQYWIOHFTKHD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | adamantane-1-carbonyl chloride |
| InChIKey | MIBQYWIOHFTKHD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)Cl |
Computed by PubChem (NCBI)