cas: 2094-72-6 — see every product listed under this CAS number, including other names
1-Adamantanecarboxylic acid chloride, 97% (CAS 2094-72-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 152480050 |
| cas | 2094-72-6 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 189.76 Pln | |
| Thermo Scientific (Acros) | 25g | 574.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Adamantane-1-carbonyl chloride (CAS 2094-72-6) is a chemical compound with the molecular formula C11H15ClO and a molecular weight of 198.69 g/mol. IUPAC name: adamantane-1-carbonyl chloride. InChIKey: MIBQYWIOHFTKHD-UHFFFAOYSA-N.
| Molecular formula | C11H15ClO |
|---|---|
| Molecular weight | 198.69 g/mol |
| IUPAC name | adamantane-1-carbonyl chloride |
| InChIKey | MIBQYWIOHFTKHD-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)Cl |
Computed by PubChem (NCBI)