cas: 3927-71-7 — see every product listed under this CAS number, including other names
1-Amino-2,3-dihydro-1H-indene-1-carboxylic acid, 98%, 98% (CAS 3927-71-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1186C6-100mg |
| cas | 3927-71-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 856.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-amino-2,3-dihydroindene-1-carboxylic acid (CAS 3927-71-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-amino-2,3-dihydroindene-1-carboxylic acid. InChIKey: HTTPGMNPPMMMOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-amino-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | HTTPGMNPPMMMOP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(=O)O)N |
Computed by PubChem (NCBI)