Products 3927-71-7
CAS 3927-71-7 appears in our catalog under these names: 1-Aminoindan-1-carboxylic acid, 95%, 1-Aminoindan-1-carboxylic acid, 1-Amino-2,3-dihydro-1H-indene-1-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, BLDpharm, Chemat. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 0,5g.
1-amino-2,3-dihydroindene-1-carboxylic acid (CAS 3927-71-7) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-amino-2,3-dihydroindene-1-carboxylic acid. InChIKey: HTTPGMNPPMMMOP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-amino-2,3-dihydroindene-1-carboxylic acid |
| InChIKey | HTTPGMNPPMMMOP-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C21)(C(=O)O)N |
Computed by PubChem (NCBI)