cas: 261-96-1 — see every product listed under this CAS number, including other names
1-Azaphenothiazine, >98.0%(GC)(T) (CAS 261-96-1) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2862-200MG |
| cas | 261-96-1 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 98.68 Pln | |
| TCI | 1g | 285.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
10H-pyrido[3,2-b][1,4]benzothiazine (CAS 261-96-1) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 10H-pyrido[3,2-b][1,4]benzothiazine. InChIKey: UKDZROJJLPDLDO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 10H-pyrido[3,2-b][1,4]benzothiazine |
| InChIKey | UKDZROJJLPDLDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC=N3 |
Computed by PubChem (NCBI)