CAS 261-96-1 appears in our catalog under these names: 1-Azaphenothiazine, 1–Azaphenothiazine, 1-Azaphenothiazine, >98.0%(GC)(T), Isothipendyl Impurity 2, 10H-Pyrido(3,2-b)(1,4)benzothiazine. Offered by: Mikromol, GLPBio, TCI, Chemat Brand, TRC. Available pack sizes: 25mg, 10g, 1g, 50g, 5g, 200mg, on request, 250mg.
10H-pyrido[3,2-b][1,4]benzothiazine (CAS 261-96-1) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 10H-pyrido[3,2-b][1,4]benzothiazine. InChIKey: UKDZROJJLPDLDO-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 10H-pyrido[3,2-b][1,4]benzothiazine |
| InChIKey | UKDZROJJLPDLDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC=N3 |
Computed by PubChem (NCBI)