CAS 84302-57-8 is the registry number for 5-Cyano-2-methyl-4-phenylthiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methyl-4-phenyl-1,3-thiazole-5-carbonitrile (CAS 84302-57-8) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 2-methyl-4-phenyl-1,3-thiazole-5-carbonitrile. InChIKey: CLGMFVPFRMXIRG-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-methyl-4-phenyl-1,3-thiazole-5-carbonitrile |
| InChIKey | CLGMFVPFRMXIRG-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C#N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)