CAS 4045-03-8 is the registry number for 2-(Thiophen-2-yl)imidazo[1,2-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
2-thiophen-2-ylimidazo[1,2-a]pyridine (CAS 4045-03-8) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 2-thiophen-2-ylimidazo[1,2-a]pyridine. InChIKey: HZILEJRCRXMSNM-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 2-thiophen-2-ylimidazo[1,2-a]pyridine |
| InChIKey | HZILEJRCRXMSNM-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN2C=C1)C3=CC=CS3 |
Computed by PubChem (NCBI)