Products 1203-55-0
CAS 1203-55-0 is the registry number for Naphtho[2,1-d]thiazol-2-ylamine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Benzo[g][1,3]benzothiazol-2-amine (CAS 1203-55-0) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: benzo[g][1,3]benzothiazol-2-amine. InChIKey: LYVQRUORYRZNMM-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | benzo[g][1,3]benzothiazol-2-amine |
| InChIKey | LYVQRUORYRZNMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2SC(=N3)N |
Computed by PubChem (NCBI)
Synonyms:
naphtho[2,1-d][1,3]thiazol-2-amine, naphtho(2,1-d)(1,3)thiazol-2-amine, Naphtho[2,1-d]thiazol-2-ylamine, Naphtho[2,1-d]thiazol-2-amine, benzo[g][1,3]benzothiazol-2-amine, Naphtho[2,1- d ]thiazol-2-ylamine, 2-aminobenzo[g]benzothiazole, Oprea1_044091, Oprea1_598584, benzo[g]benzothiazole-2-ylamine