CAS 122957-57-7 appears in our catalog under these names: 4-(4-Methylthiazol-5-yl)benzonitrile, 95%, 4–(4–Methylthiazol–5–yl)benzonitrile, -4(4-methylthiazol-5-yl)benzonitrile. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
4-(4-methyl-1,3-thiazol-5-yl)benzonitrile (CAS 122957-57-7) is a chemical compound with the molecular formula C11H8N2S and a molecular weight of 200.26 g/mol. IUPAC name: 4-(4-methyl-1,3-thiazol-5-yl)benzonitrile. InChIKey: REUDLMVWBUGLDA-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-(4-methyl-1,3-thiazol-5-yl)benzonitrile |
| InChIKey | REUDLMVWBUGLDA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)