cas: 1259323-78-8 — see every product listed under this CAS number, including other names
1-Azetidinecarboxylic acid, 3-(4-carboxyphenoxy)-, 1-(1,1-dimethylethyl) ester, 95%, 95% (CAS 1259323-78-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110GDE-100mg |
| cas | 1259323-78-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2142.80 Pln | |
| Chemat | 10g | 4226.00 Pln | |
| Chemat | 25g | 5867.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid (CAS 1259323-78-8) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid. InChIKey: BWILLSLXSIKGTH-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid |
| InChIKey | BWILLSLXSIKGTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)