cas: 1259323-78-8 — see every product listed under this CAS number, including other names
4-{[1-(tert-Butoxycarbonyl)azetidin-3-yl]oxy}benzoic acid, 95% (CAS 1259323-78-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F371235-100MG |
| cas | 1259323-78-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 1950.37 Pln | |
| Fluorochem | 25g | 9536.24 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid (CAS 1259323-78-8) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid. InChIKey: BWILLSLXSIKGTH-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]oxybenzoic acid |
| InChIKey | BWILLSLXSIKGTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)