cas: 126937-43-7 — see every product listed under this CAS number, including other names
1-Benzyl 2-methyl piperazine-1,2-dicarboxylate 97% (CAS 126937-43-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A374423-250mg |
| cas | 126937-43-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 10g | 1076.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A374423 |
1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate (CAS 126937-43-7) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate. InChIKey: HOLPEQRNMJTIIX-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl piperazine-1,2-dicarboxylate |
| InChIKey | HOLPEQRNMJTIIX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)