cas: 4706-43-8 — see every product listed under this CAS number, including other names
1-Benzyl-1H-benzo[d][1,2,3]triazole 95% (CAS 4706-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144347-100mg |
| cas | 4706-43-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144347 |
1-benzylbenzotriazole (CAS 4706-43-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1-benzylbenzotriazole. InChIKey: OQVSPZZIBWDHOF-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1-benzylbenzotriazole |
| InChIKey | OQVSPZZIBWDHOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)