cas: 4706-43-8 — see every product listed under this CAS number, including other names
1-Benzyl-1H-benzo[d][1,2,3]triazole, 95%, 95% (CAS 4706-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLPO-100mg |
| cas | 4706-43-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 290.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzylbenzotriazole (CAS 4706-43-8) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 1-benzylbenzotriazole. InChIKey: OQVSPZZIBWDHOF-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 1-benzylbenzotriazole |
| InChIKey | OQVSPZZIBWDHOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)