1-Benzyl-1H-indole, 95%
cas: 3377-71-7 — see every product listed under this CAS number, including other names
1-Benzyl-1H-indole, 95% (CAS 3377-71-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F322019-250MG |
| cas | 3377-71-7 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 284.29 Pln | |
| Fluorochem | 5g | 810.15 Pln | |
| Fluorochem | 25g | 2455.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylindole (CAS 3377-71-7) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 1-benzylindole. InChIKey: NJZQOCCEDXRQJM-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 1-benzylindole |
| InChIKey | NJZQOCCEDXRQJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)