CAS 101096-72-4 appears in our catalog under these names: 4-Benzylphenylacetonitrile, 4-Benzylphenylacetonitrile, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-benzylphenyl)acetonitrile (CAS 101096-72-4) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2-(4-benzylphenyl)acetonitrile. InChIKey: RNZDBGKQDKFAPR-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-(4-benzylphenyl)acetonitrile |
| InChIKey | RNZDBGKQDKFAPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC=C(C=C2)CC#N |
Computed by PubChem (NCBI)