CAS 1355247-46-9 is the registry number for 2-(3,5-dimethylphenyl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3,5-dimethylphenyl)benzonitrile (CAS 1355247-46-9) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)benzonitrile. InChIKey: LMAKYIBNWIYCSV-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)benzonitrile |
| InChIKey | LMAKYIBNWIYCSV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=CC=C2C#N)C |
Computed by PubChem (NCBI)