Products 5558-67-8
CAS 5558-67-8 appears in our catalog under these names: 2,2-Diphenylpropionitrile, 97%, 2,2-Diphenylpropionitrile, 98%, 2，2–Diphenylpropionitrile, 2,2-Diphenylpropionitrile, 97% , 2,2-Diphenylpropionitrile, >98.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 25g, 1g, 5g, 10g, 50g, 100g.
2,2-diphenylpropanenitrile (CAS 5558-67-8) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2,2-diphenylpropanenitrile. InChIKey: DPVHBXFSKLKYIQ-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2,2-diphenylpropanenitrile |
| InChIKey | DPVHBXFSKLKYIQ-UHFFFAOYSA-N |
| SMILES | CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)