CAS 605-67-4 appears in our catalog under these names: 2,4-Dimethylbenzo[h]quinoline, 95%, 2,4-Dimethylbenzo(h)quinoline, 95%, 2,4–Dimethylbenzo(h)quinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
2,4-dimethylbenzo[h]quinoline (CAS 605-67-4) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 2,4-dimethylbenzo[h]quinoline. InChIKey: VPSXZUORXQYBAT-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 2,4-dimethylbenzo[h]quinoline |
| InChIKey | VPSXZUORXQYBAT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC3=CC=CC=C32)C |
Computed by PubChem (NCBI)