CAS 374081-26-2 appears in our catalog under these names: 2,2-Diphenylethylisocyanide, 95%, 2,2-Diphenylethylisocyanide 95%, 2,2-Diphenylethylisocyanide, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2-isocyano-1-phenylethyl)benzene (CAS 374081-26-2) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: (2-isocyano-1-phenylethyl)benzene. InChIKey: JIPPKVDKFJRSEG-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | (2-isocyano-1-phenylethyl)benzene |
| InChIKey | JIPPKVDKFJRSEG-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]CC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)