CAS 3377-71-7 appears in our catalog under these names: 1-Benzyl-1H-indole, 97%, 1-Benzylindole, 97% , 1-Benzyl-1H-indole 97%, 1-Benzyl-1H-indole, 98%, 98%, 1-Benzyl-1H-indole, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
1-benzylindole (CAS 3377-71-7) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 1-benzylindole. InChIKey: NJZQOCCEDXRQJM-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 1-benzylindole |
| InChIKey | NJZQOCCEDXRQJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)