cas: 479057-79-9 — see every product listed under this CAS number, including other names
1-Boc-4-(chloromethyl)piperidine, 97%, 97% (CAS 479057-79-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E2O-100mg |
| cas | 479057-79-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 779.60 Pln | |
| Chemat | 10g | 1307.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(chloromethyl)piperidine-1-carboxylate (CAS 479057-79-9) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: tert-butyl 4-(chloromethyl)piperidine-1-carboxylate. InChIKey: CTSABEXZMPJSGO-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate |
| InChIKey | CTSABEXZMPJSGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCl |
Computed by PubChem (NCBI)