cas: 479057-79-9 — see every product listed under this CAS number, including other names
4-Chloromethyl-piperidine-1-carboxylic acid tert-butyl ester, 96% (CAS 479057-79-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088270-250MG |
| cas | 479057-79-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 940.31 Pln | |
| Fluorochem | 10g | 1658.81 Pln | |
| Fluorochem | 25g | 4048.59 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(chloromethyl)piperidine-1-carboxylate (CAS 479057-79-9) is a chemical compound with the molecular formula C11H20ClNO2 and a molecular weight of 233.73 g/mol. IUPAC name: tert-butyl 4-(chloromethyl)piperidine-1-carboxylate. InChIKey: CTSABEXZMPJSGO-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO2 |
|---|---|
| Molecular weight | 233.73 g/mol |
| IUPAC name | tert-butyl 4-(chloromethyl)piperidine-1-carboxylate |
| InChIKey | CTSABEXZMPJSGO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCl |
Computed by PubChem (NCBI)