cas: 1646161-42-3 — see every product listed under this CAS number, including other names
1-Bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene (CAS 1646161-42-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630203-5G |
| cas | 1646161-42-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2481.44 Pln | |
| Fluorochem | 10g | 4163.14 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene (CAS 1646161-42-3) is a chemical compound with the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. IUPAC name: 1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene. InChIKey: GJDWKPDOEXVYEP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O |
|---|---|
| Molecular weight | 269.06 g/mol |
| IUPAC name | 1-bromo-2-(methoxymethyl)-4-(trifluoromethyl)benzene |
| InChIKey | GJDWKPDOEXVYEP-UHFFFAOYSA-N |
| SMILES | COCC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)