cas: 20717-79-7 — see every product listed under this CAS number, including other names
1-Bromo-2-naphthoic acid, 95%, 95% (CAS 20717-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113IVR-250mg |
| cas | 20717-79-7 |
| size | 250mg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 100g | 1187.60 Pln | |
| Chemat | 500g | 5764.80 Pln | |
| Chemat | 1kg | 9194.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-bromonaphthalene-2-carboxylic acid (CAS 20717-79-7) is a chemical compound with the molecular formula C11H7BrO2 and a molecular weight of 251.08 g/mol. IUPAC name: 1-bromonaphthalene-2-carboxylic acid. InChIKey: VUVIRKAVBZITDO-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO2 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 1-bromonaphthalene-2-carboxylic acid |
| InChIKey | VUVIRKAVBZITDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2Br)C(=O)O |
Computed by PubChem (NCBI)