cas: 1379358-18-5 — see every product listed under this CAS number, including other names
1-Bromo-3,5-dimethoxy-2-nitrobenzene 97% (CAS 1379358-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128610-100mg |
| cas | 1379358-18-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 314.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A128610 |
1-bromo-3,5-dimethoxy-2-nitrobenzene (CAS 1379358-18-5) is a chemical compound with the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. IUPAC name: 1-bromo-3,5-dimethoxy-2-nitrobenzene. InChIKey: KODPKAQPETYBEG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO4 |
|---|---|
| Molecular weight | 262.06 g/mol |
| IUPAC name | 1-bromo-3,5-dimethoxy-2-nitrobenzene |
| InChIKey | KODPKAQPETYBEG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)