cas: 133057-82-6 — see every product listed under this CAS number, including other names
1-Bromo-4-benzyloxy-3-fluorobenzene, 98% (CAS 133057-82-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302310-5G |
| cas | 133057-82-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 25g | 1091.30 Pln | |
| Fluorochem | 100g | 3449.84 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-fluoro-1-phenylmethoxybenzene (CAS 133057-82-6) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 4-bromo-2-fluoro-1-phenylmethoxybenzene. InChIKey: HCVUDNMNSPYSHS-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-phenylmethoxybenzene |
| InChIKey | HCVUDNMNSPYSHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)