cas: 118664-99-6 — see every product listed under this CAS number, including other names
1-Chloro-2-fluoro-4-methyl-5-nitrobenzene, 97%, 97% (CAS 118664-99-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 500g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E8J-10g |
| cas | 118664-99-6 |
| size | 10g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 198.80 Pln | |
| Chemat | 500g | 5145.60 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 100g | 1254.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloro-2-fluoro-4-methyl-5-nitrobenzene (CAS 118664-99-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 1-chloro-2-fluoro-4-methyl-5-nitrobenzene. InChIKey: WZEMBGOGKOKTDW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-4-methyl-5-nitrobenzene |
| InChIKey | WZEMBGOGKOKTDW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)