cas: 118664-99-6 — see every product listed under this CAS number, including other names
5-Chloro-4-fluoro-2-methylnitrobenzene, 98% (CAS 118664-99-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F044254-5G |
| cas | 118664-99-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 466.52 Pln | |
| Fluorochem | 100g | 1570.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-chloro-2-fluoro-4-methyl-5-nitrobenzene (CAS 118664-99-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 1-chloro-2-fluoro-4-methyl-5-nitrobenzene. InChIKey: WZEMBGOGKOKTDW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-4-methyl-5-nitrobenzene |
| InChIKey | WZEMBGOGKOKTDW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)